C11H18O6 — CID 134916387
methyl (3aR,5S,6S,6aR)-6-hydroxy-2,2,3a,6a-tetramethyl-5,6-dihydrofuro[2,3-d][1,3]dioxole-5-carboxylate (PubChem CID 134916387) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is methyl (3aR,5S,6S,6aR)-6-hydroxy-2,2,3a,6a-tetramethyl-5,6-dihydrofuro[2,3-d][1,3]dioxole-5-carboxylate.
| Compound Name | methyl (3aR,5S,6S,6aR)-6-hydroxy-2,2,3a,6a-tetramethyl-5,6-dihydrofuro[2,3-d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 134916387 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | methyl (3aR,5S,6S,6aR)-6-hydroxy-2,2,3a,6a-tetramethyl-5,6-dihydrofuro[2,3-d][1,3]dioxole-5-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@]2(C)OC(C)(C)O[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C11H18O6/c1-9(2)16-10(3)7(12)6(8(13)14-5)15-11(10,4)17-9/h6-7,12H,1-5H3/t6-,7-,10+,11+/m0/s1 |
| InChIKey | YSIZDXGATDLKTR-JRPBRRGXSA-N |
| XLogP | 0.18 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |