C28H46O3 — CID 134916419
methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-7-formyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate (PubChem CID 134916419) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-7-formyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate.
| Compound Name | methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-7-formyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate |
|---|---|
| PubChem CID | 134916419 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-7-formyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate |
| SMILES | COC(=O)CC[C@@]1(C)C(C=O)=CC[C@H]2[C@@H]3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C28H46O3/c1-19(2)8-7-9-20(3)23-12-13-24-22-11-10-21(18-29)27(4,17-15-26(30)31-6)25(22)14-16-28(23,24)5/h10,18-20,22-25H,7-9,11-17H2,1-6H3/t20-,22+,23-,24+,25+,27+,28-/m1/s1 |
| InChIKey | IWXGNPNITSLYOW-CLZLZETHSA-N |
| XLogP | 7.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|