C10H18O2 — CID 134916431
methyl 2,4,5-trimethylhex-5-enoate (PubChem CID 134916431) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is methyl 2,4,5-trimethylhex-5-enoate.
| Compound Name | methyl 2,4,5-trimethylhex-5-enoate |
|---|---|
| PubChem CID | 134916431 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | methyl 2,4,5-trimethylhex-5-enoate |
| SMILES | C=C(C)C(C)CC(C)C(=O)OC |
| InChI | InChI=1S/C10H18O2/c1-7(2)8(3)6-9(4)10(11)12-5/h8-9H,1,6H2,2-5H3 |
| InChIKey | LAFKODLFQRHKCA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|