C13H16O5 — CID 134916449
diethyl (1R,4S,5S)-8-oxabicyclo[3.2.1]octa-2,6-diene-2,4-dicarboxylate (PubChem CID 134916449) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is diethyl (1R,4S,5S)-8-oxabicyclo[3.2.1]octa-2,6-diene-2,4-dicarboxylate.
| Compound Name | diethyl (1R,4S,5S)-8-oxabicyclo[3.2.1]octa-2,6-diene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134916449 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | diethyl (1R,4S,5S)-8-oxabicyclo[3.2.1]octa-2,6-diene-2,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C[C@H](C(=O)OCC)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C13H16O5/c1-3-16-12(14)8-7-9(13(15)17-4-2)11-6-5-10(8)18-11/h5-8,10-11H,3-4H2,1-2H3/t8-,10-,11+/m0/s1 |
| InChIKey | COPXIBVHMLWJMD-INTQDDNPSA-N |
| XLogP | 0.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|