C24H28O5S — CID 134916467
[2-[acetyloxy(phenylsulfanyl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 134916467) has the molecular formula C24H28O5S and a molecular weight of 428.55 g/mol. Its IUPAC name is [2-[acetyloxy(phenylsulfanyl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[acetyloxy(phenylsulfanyl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 134916467 |
| Molecular Formula | C24H28O5S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [2-[acetyloxy(phenylsulfanyl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(C(OC(C)=O)Sc1ccccc1)O2 |
| InChI | InChI=1S/C24H28O5S/c1-14-15(2)22-20(16(3)21(14)27-17(4)25)12-13-24(6,29-22)23(28-18(5)26)30-19-10-8-7-9-11-19/h7-11,23H,12-13H2,1-6H3 |
| InChIKey | HGPHCXLIXUJTDC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|