About [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate
[(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate (PubChem CID 134916583) has the molecular formula C25H26O4S
and a molecular weight of 422.55 g/mol. Its IUPAC name is [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate.
Molecular Properties
| Compound Name | [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate |
| PubChem CID | 134916583 |
| Molecular Formula | C25H26O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate |
| SMILES | C[C@@H](C(=O)O[C@H]1CCCC[C@@H]1S(=O)(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C25H26O4S/c1-18(19-9-3-2-4-10-19)25(26)29-23-13-7-8-14-24(23)30(27,28)22-16-15-20-11-5-6-12-21(20)17-22/h2-6,9-12,15-18,23-24H,7-8,13-14H2,1H3/t18-,23+,24+/m1/s1 |
| InChIKey | HGNWDPMXMYUZDZ-DKLXNKCPSA-N |
| XLogP | 5.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate?
The IUPAC name of [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate (CID 134916583) is [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate.
What is the SMILES notation for [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate?
The canonical SMILES for [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate is C[C@@H](C(=O)O[C@H]1CCCC[C@@H]1S(=O)(=O)c1ccc2ccccc2c1)c1ccccc1.
What is the InChIKey of [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate?
The InChIKey is HGNWDPMXMYUZDZ-DKLXNKCPSA-N. The full InChI is InChI=1S/C25H26O4S/c1-18(19-9-3-2-4-10-19)25(26)29-23-13-7-8-14-24(23)30(27,28)22-16-15-20-11-5-6-12-21(20)17-22/h2-6,9-12,15-18,23-24H,7-8,13-14H2,1H3/t18-,23+,24+/m1/s1.
What are the key properties of [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate?
[(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate has a molecular weight of 422.55 g/mol, XLogP of 5.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-naphthalen-2-ylsulfonylcyclohexyl] (2R)-2-phenylpropanoate is sourced from PubChem (CID 134916583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).