About ethyl 5-ethoxy-2,5-dimethylhexanoate
ethyl 5-ethoxy-2,5-dimethylhexanoate (PubChem CID 134916705) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is ethyl 5-ethoxy-2,5-dimethylhexanoate.
Molecular Properties
| Compound Name | ethyl 5-ethoxy-2,5-dimethylhexanoate |
| PubChem CID | 134916705 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | ethyl 5-ethoxy-2,5-dimethylhexanoate |
| SMILES | CCOC(=O)C(C)CCC(C)(C)OCC |
| InChI | InChI=1S/C12H24O3/c1-6-14-11(13)10(3)8-9-12(4,5)15-7-2/h10H,6-9H2,1-5H3 |
| InChIKey | FEFVRPJAXGNGAX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-ethoxy-2,5-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-ethoxy-2,5-dimethylhexanoate?
The IUPAC name of ethyl 5-ethoxy-2,5-dimethylhexanoate (CID 134916705) is ethyl 5-ethoxy-2,5-dimethylhexanoate.
What is the SMILES notation for ethyl 5-ethoxy-2,5-dimethylhexanoate?
The canonical SMILES for ethyl 5-ethoxy-2,5-dimethylhexanoate is CCOC(=O)C(C)CCC(C)(C)OCC.
What is the InChIKey of ethyl 5-ethoxy-2,5-dimethylhexanoate?
The InChIKey is FEFVRPJAXGNGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-6-14-11(13)10(3)8-9-12(4,5)15-7-2/h10H,6-9H2,1-5H3.
What are the key properties of ethyl 5-ethoxy-2,5-dimethylhexanoate?
ethyl 5-ethoxy-2,5-dimethylhexanoate has a molecular weight of 216.32 g/mol, XLogP of 2.78, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-ethoxy-2,5-dimethylhexanoate is sourced from PubChem (CID 134916705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).