C16H18N4O — CID 134916914
2,4-dimethyl-6,6-diphenyl-1,2,4,5-tetrazinan-3-one (PubChem CID 134916914) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2,4-dimethyl-6,6-diphenyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 2,4-dimethyl-6,6-diphenyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 134916914 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2,4-dimethyl-6,6-diphenyl-1,2,4,5-tetrazinan-3-one |
| SMILES | CN1NC(c2ccccc2)(c2ccccc2)NN(C)C1=O |
| InChI | InChI=1S/C16H18N4O/c1-19-15(21)20(2)18-16(17-19,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,17-18H,1-2H3 |
| InChIKey | ZBISRAGVOSBGJU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |