C39H47NO6 — CID 134916965
(1S,2S,3S,4R,5R)-N-(butoxymethoxy)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclopentan-1-amine (PubChem CID 134916965) has the molecular formula C39H47NO6 and a molecular weight of 625.81 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-N-(butoxymethoxy)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclopentan-1-amine.
| Compound Name | (1S,2S,3S,4R,5R)-N-(butoxymethoxy)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 134916965 |
| Molecular Formula | C39H47NO6 |
| Molecular Weight | 625.81 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | (1S,2S,3S,4R,5R)-N-(butoxymethoxy)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclopentan-1-amine |
| SMILES | CCCCOCON[C@H]1[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H47NO6/c1-2-3-24-41-30-46-40-36-35(29-42-25-31-16-8-4-9-17-31)37(43-26-32-18-10-5-11-19-32)39(45-28-34-22-14-7-15-23-34)38(36)44-27-33-20-12-6-13-21-33/h4-23,35-40H,2-3,24-30H2,1H3/t35-,36-,37+,38-,39-/m0/s1 |
| InChIKey | HDAKLZWLOVCFJP-XKWAVOGESA-N |
| XLogP | 7.25 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.81 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|