C26H50O5Si — CID 134917135
7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 134917135) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 134917135 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O)CC(O)[C@@H]1CCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O5Si/c1-7-8-11-14-20(31-32(5,6)26(2,3)4)17-18-22-21(23(27)19-24(22)28)15-12-9-10-13-16-25(29)30/h17-18,20-24,27-28H,7-16,19H2,1-6H3,(H,29,30)/b18-17+/t20-,21+,22+,23?,24+/m0/s1 |
| InChIKey | PVYIZACEWXPBPI-JEJVYKBZSA-N |
| XLogP | 6.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|