About 1,3-dicyclohexyl-1,3-diethylselenourea
1,3-dicyclohexyl-1,3-diethylselenourea (PubChem CID 134917218) has the molecular formula C17H32N2Se
and a molecular weight of 343.42 g/mol. Its IUPAC name is 1,3-dicyclohexyl-1,3-diethylselenourea.
Molecular Properties
| Compound Name | 1,3-dicyclohexyl-1,3-diethylselenourea |
| PubChem CID | 134917218 |
| Molecular Formula | C17H32N2Se |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1,3-dicyclohexyl-1,3-diethylselenourea |
| SMILES | CCN(C(=[Se])N(CC)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H32N2Se/c1-3-18(15-11-7-5-8-12-15)17(20)19(4-2)16-13-9-6-10-14-16/h15-16H,3-14H2,1-2H3 |
| InChIKey | KXJYAIOCYNQUNQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dicyclohexyl-1,3-diethylselenourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexyl-1,3-diethylselenourea?
The IUPAC name of 1,3-dicyclohexyl-1,3-diethylselenourea (CID 134917218) is 1,3-dicyclohexyl-1,3-diethylselenourea.
What is the SMILES notation for 1,3-dicyclohexyl-1,3-diethylselenourea?
The canonical SMILES for 1,3-dicyclohexyl-1,3-diethylselenourea is CCN(C(=[Se])N(CC)C1CCCCC1)C1CCCCC1.
What is the InChIKey of 1,3-dicyclohexyl-1,3-diethylselenourea?
The InChIKey is KXJYAIOCYNQUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2Se/c1-3-18(15-11-7-5-8-12-15)17(20)19(4-2)16-13-9-6-10-14-16/h15-16H,3-14H2,1-2H3.
What are the key properties of 1,3-dicyclohexyl-1,3-diethylselenourea?
1,3-dicyclohexyl-1,3-diethylselenourea has a molecular weight of 343.42 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexyl-1,3-diethylselenourea is sourced from PubChem (CID 134917218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).