C19H10F5NS2 — CID 134917245
N-(2,3,4,5,6-pentafluorophenyl)-1,1-bis(phenylsulfanyl)methanimine (PubChem CID 134917245) has the molecular formula C19H10F5NS2 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-1,1-bis(phenylsulfanyl)methanimine.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-1,1-bis(phenylsulfanyl)methanimine |
|---|---|
| PubChem CID | 134917245 |
| Molecular Formula | C19H10F5NS2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-1,1-bis(phenylsulfanyl)methanimine |
| SMILES | Fc1c(F)c(F)c(N=C(Sc2ccccc2)Sc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C19H10F5NS2/c20-13-14(21)16(23)18(17(24)15(13)22)25-19(26-11-7-3-1-4-8-11)27-12-9-5-2-6-10-12/h1-10H |
| InChIKey | XWIIFWVSZQOSSG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|