About tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate (PubChem CID 134917289) has the molecular formula C12H20F3N3O4
and a molecular weight of 327.30 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate |
| PubChem CID | 134917289 |
| Molecular Formula | C12H20F3N3O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NC(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20F3N3O4/c1-10(2,3)21-8(19)16-7(18-12(13,14)15)17-9(20)22-11(4,5)6/h1-6H3,(H2,16,17,18,19,20) |
| InChIKey | YCLRCBBZTJASJO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate?
The IUPAC name of tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate (CID 134917289) is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate.
What is the SMILES notation for tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate?
The canonical SMILES for tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate is CC(C)(C)OC(=O)NC(=NC(F)(F)F)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate?
The InChIKey is YCLRCBBZTJASJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N3O4/c1-10(2,3)21-8(19)16-7(18-12(13,14)15)17-9(20)22-11(4,5)6/h1-6H3,(H2,16,17,18,19,20).
What are the key properties of tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate?
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate has a molecular weight of 327.30 g/mol, XLogP of 2.91, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(trifluoromethyl)carbamimidoyl]carbamate is sourced from PubChem (CID 134917289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).