C36H30N6O2 — CID 134917432
ethyl 1,4,6,8,9-pentakis-phenyl-1,2,4,6,7,9-hexazaspiro[4.4]nona-2,7-diene-3-carboxylate (PubChem CID 134917432) has the molecular formula C36H30N6O2 and a molecular weight of 578.68 g/mol. Its IUPAC name is ethyl 1,4,6,8,9-pentakis-phenyl-1,2,4,6,7,9-hexazaspiro[4.4]nona-2,7-diene-3-carboxylate.
| Compound Name | ethyl 1,4,6,8,9-pentakis-phenyl-1,2,4,6,7,9-hexazaspiro[4.4]nona-2,7-diene-3-carboxylate |
|---|---|
| PubChem CID | 134917432 |
| Molecular Formula | C36H30N6O2 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | ethyl 1,4,6,8,9-pentakis-phenyl-1,2,4,6,7,9-hexazaspiro[4.4]nona-2,7-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)C2(N(c3ccccc3)N=C(c3ccccc3)N2c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C36H30N6O2/c1-2-44-35(43)34-38-42(32-26-16-7-17-27-32)36(40(34)30-22-12-5-13-23-30)39(29-20-10-4-11-21-29)33(28-18-8-3-9-19-28)37-41(36)31-24-14-6-15-25-31/h3-27H,2H2,1H3 |
| InChIKey | KXLBCXKVYCNWKH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 63.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |