C19H22N4O3 — CID 134917483
ethyl 2-(3-methyl-6-oxo-3,5-diphenyl-1,2,4,5-tetrazinan-1-yl)acetate (PubChem CID 134917483) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is ethyl 2-(3-methyl-6-oxo-3,5-diphenyl-1,2,4,5-tetrazinan-1-yl)acetate.
| Compound Name | ethyl 2-(3-methyl-6-oxo-3,5-diphenyl-1,2,4,5-tetrazinan-1-yl)acetate |
|---|---|
| PubChem CID | 134917483 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | ethyl 2-(3-methyl-6-oxo-3,5-diphenyl-1,2,4,5-tetrazinan-1-yl)acetate |
| SMILES | CCOC(=O)CN1NC(C)(c2ccccc2)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H22N4O3/c1-3-26-17(24)14-22-18(25)23(16-12-8-5-9-13-16)21-19(2,20-22)15-10-6-4-7-11-15/h4-13,20-21H,3,14H2,1-2H3 |
| InChIKey | HVTAJWDDPJKJER-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |