About methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate
methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate (PubChem CID 134917544) has the molecular formula C15H13NO4S
and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate.
Molecular Properties
| Compound Name | methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate |
| PubChem CID | 134917544 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate |
| SMILES | COC(=O)C([N+](=O)[O-])=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13NO4S/c1-20-15(17)14(16(18)19)21(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | JEQMQERDAWMBHT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate?
The IUPAC name of methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate (CID 134917544) is methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate.
What is the SMILES notation for methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate?
The canonical SMILES for methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate is COC(=O)C([N+](=O)[O-])=S(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate?
The InChIKey is JEQMQERDAWMBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4S/c1-20-15(17)14(16(18)19)21(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate?
methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate has a molecular weight of 303.34 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(diphenyl-λ4-sulfanylidene)-2-nitroacetate is sourced from PubChem (CID 134917544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).