C12H18O5S — CID 134917625
(3aS,6R,6aS)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-thione (PubChem CID 134917625) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is (3aS,6R,6aS)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-thione.
| Compound Name | (3aS,6R,6aS)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-thione |
|---|---|
| PubChem CID | 134917625 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (3aS,6R,6aS)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-thione |
| SMILES | CC1(C)OCC([C@H]2OC(=S)[C@H]3OC(C)(C)O[C@H]32)O1 |
| InChI | InChI=1S/C12H18O5S/c1-11(2)13-5-6(15-11)7-8-9(10(18)14-7)17-12(3,4)16-8/h6-9H,5H2,1-4H3/t6?,7-,8+,9+/m1/s1 |
| InChIKey | HMFQVPLNWBIFDI-UXGQUHLOSA-N |
| XLogP | 1.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|