C29H44O4Si2 — CID 134917633
(4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-2-one (PubChem CID 134917633) has the molecular formula C29H44O4Si2 and a molecular weight of 512.84 g/mol. Its IUPAC name is (4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-2-one.
| Compound Name | (4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-2-one |
|---|---|
| PubChem CID | 134917633 |
| Molecular Formula | C29H44O4Si2 |
| Molecular Weight | 512.84 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxan-2-one |
| SMILES | C[C@H]1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H44O4Si2/c1-22-25(33-34(8,9)28(2,3)4)20-27(30)32-26(22)21-31-35(29(5,6)7,23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-19,22,25-26H,20-21H2,1-9H3/t22-,25-,26+/m1/s1 |
| InChIKey | CUNLTEMDNYBQEN-RCXJIHSJSA-N |
| XLogP | 5.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.84 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|