C26H29NO6 — CID 134917715
benzyl (2S)-1-(2,3-dioxo-7-phenylmethoxyheptanoyl)pyrrolidine-2-carboxylate (PubChem CID 134917715) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is benzyl (2S)-1-(2,3-dioxo-7-phenylmethoxyheptanoyl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-(2,3-dioxo-7-phenylmethoxyheptanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134917715 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | benzyl (2S)-1-(2,3-dioxo-7-phenylmethoxyheptanoyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(CCCCOCc1ccccc1)C(=O)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H29NO6/c28-23(15-7-8-17-32-18-20-10-3-1-4-11-20)24(29)25(30)27-16-9-14-22(27)26(31)33-19-21-12-5-2-6-13-21/h1-6,10-13,22H,7-9,14-19H2/t22-/m0/s1 |
| InChIKey | YBONGBCZELEFAD-QFIPXVFZSA-N |
| XLogP | 3.25 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|