C27H33NO5 — CID 134917716
7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]heptane-1,2,3-trione (PubChem CID 134917716) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]heptane-1,2,3-trione.
| Compound Name | 7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]heptane-1,2,3-trione |
|---|---|
| PubChem CID | 134917716 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]heptane-1,2,3-trione |
| SMILES | O=C(CCCCOCc1ccccc1)C(=O)C(=O)N1CCCC[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C27H33NO5/c29-25(16-8-10-18-32-19-22-11-3-1-4-12-22)26(30)27(31)28-17-9-7-15-24(28)21-33-20-23-13-5-2-6-14-23/h1-6,11-14,24H,7-10,15-21H2/t24-/m0/s1 |
| InChIKey | WDMMGUPSGLUMIF-DEOSSOPVSA-N |
| XLogP | 4.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|