About 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one
3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 134917855) has the molecular formula C10H15NO2
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| PubChem CID | 134917855 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C\N1C(=O)OCC1C(C)C |
| InChI | InChI=1S/C10H15NO2/c1-4-5-6-11-9(8(2)3)7-13-10(11)12/h4-6,8-9H,1,7H2,2-3H3/b6-5- |
| InChIKey | CVYWIQWRVNMJJL-WAYWQWQTSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one (CID 134917855) is 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one is C=C/C=C\N1C(=O)OCC1C(C)C.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The InChIKey is CVYWIQWRVNMJJL-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H15NO2/c1-4-5-6-11-9(8(2)3)7-13-10(11)12/h4-6,8-9H,1,7H2,2-3H3/b6-5-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one has a molecular weight of 181.24 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one is sourced from PubChem (CID 134917855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).