About (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide
(2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide (PubChem CID 134917882) has the molecular formula C20H27NO2S
and a molecular weight of 345.51 g/mol. Its IUPAC name is (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide.
Molecular Properties
| Compound Name | (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide |
| PubChem CID | 134917882 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide |
| SMILES | CCCC[C@H](C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H27NO2S/c1-4-5-12-17(18-13-9-14-24-18)20(23)21(3)15(2)19(22)16-10-7-6-8-11-16/h6-11,13-15,17,19,22H,4-5,12H2,1-3H3/t15-,17-,19+/m0/s1 |
| InChIKey | YVWXMPOIEBERFB-VDZJLULYSA-N |
| XLogP | 4.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide?
The IUPAC name of (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide (CID 134917882) is (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide.
What is the SMILES notation for (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide?
The canonical SMILES for (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide is CCCC[C@H](C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)c1cccs1.
What is the InChIKey of (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide?
The InChIKey is YVWXMPOIEBERFB-VDZJLULYSA-N. The full InChI is InChI=1S/C20H27NO2S/c1-4-5-12-17(18-13-9-14-24-18)20(23)21(3)15(2)19(22)16-10-7-6-8-11-16/h6-11,13-15,17,19,22H,4-5,12H2,1-3H3/t15-,17-,19+/m0/s1.
What are the key properties of (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide?
(2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide has a molecular weight of 345.51 g/mol, XLogP of 4.60, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-thiophen-2-ylhexanamide is sourced from PubChem (CID 134917882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).