C30H55NO3Si — CID 134917931
(2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(2-tributylsilyloxyethyl)hexanamide (PubChem CID 134917931) has the molecular formula C30H55NO3Si and a molecular weight of 505.86 g/mol. Its IUPAC name is (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(2-tributylsilyloxyethyl)hexanamide.
| Compound Name | (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(2-tributylsilyloxyethyl)hexanamide |
|---|---|
| PubChem CID | 134917931 |
| Molecular Formula | C30H55NO3Si |
| Molecular Weight | 505.86 g/mol |
| Exact Mass | 505.40 |
| IUPAC Name | (2R)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(2-tributylsilyloxyethyl)hexanamide |
| SMILES | CCCC[C@H](CCO[Si](CCCC)(CCCC)CCCC)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C30H55NO3Si/c1-7-11-18-28(30(33)31(6)26(5)29(32)27-19-16-15-17-20-27)21-22-34-35(23-12-8-2,24-13-9-3)25-14-10-4/h15-17,19-20,26,28-29,32H,7-14,18,21-25H2,1-6H3/t26-,28+,29+/m0/s1 |
| InChIKey | CRXPZLFEDHOXGN-WIIGKZCBSA-N |
| XLogP | 8.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.86 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|