C15H16F3NO3 — CID 134917948
methyl (2S)-2-[(R)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl]pent-4-enoate (PubChem CID 134917948) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is methyl (2S)-2-[(R)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl]pent-4-enoate.
| Compound Name | methyl (2S)-2-[(R)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl]pent-4-enoate |
|---|---|
| PubChem CID | 134917948 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl (2S)-2-[(R)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl]pent-4-enoate |
| SMILES | C=CC[C@H](C(=O)OC)[C@@H](NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H16F3NO3/c1-3-7-11(13(20)22-2)12(10-8-5-4-6-9-10)19-14(21)15(16,17)18/h3-6,8-9,11-12H,1,7H2,2H3,(H,19,21)/t11-,12-/m0/s1 |
| InChIKey | ZJZJIMINZINYCX-RYUDHWBXSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|