C10H14F3NO3 — CID 134917985
methyl (2S)-2-[(1S)-1-[(2,2,2-trifluoroacetyl)amino]ethyl]pent-4-enoate (PubChem CID 134917985) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is methyl (2S)-2-[(1S)-1-[(2,2,2-trifluoroacetyl)amino]ethyl]pent-4-enoate.
| Compound Name | methyl (2S)-2-[(1S)-1-[(2,2,2-trifluoroacetyl)amino]ethyl]pent-4-enoate |
|---|---|
| PubChem CID | 134917985 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | methyl (2S)-2-[(1S)-1-[(2,2,2-trifluoroacetyl)amino]ethyl]pent-4-enoate |
| SMILES | C=CC[C@H](C(=O)OC)[C@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO3/c1-4-5-7(8(15)17-3)6(2)14-9(16)10(11,12)13/h4,6-7H,1,5H2,2-3H3,(H,14,16)/t6-,7-/m0/s1 |
| InChIKey | VAYIJOLDCXVONF-BQBZGAKWSA-N |
| XLogP | 1.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|