C29H53NO3Si — CID 134917989
(2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethyl-2-(2-tributylsilyloxyethyl)butanamide (PubChem CID 134917989) has the molecular formula C29H53NO3Si and a molecular weight of 491.83 g/mol. Its IUPAC name is (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethyl-2-(2-tributylsilyloxyethyl)butanamide.
| Compound Name | (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethyl-2-(2-tributylsilyloxyethyl)butanamide |
|---|---|
| PubChem CID | 134917989 |
| Molecular Formula | C29H53NO3Si |
| Molecular Weight | 491.83 g/mol |
| Exact Mass | 491.38 |
| IUPAC Name | (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethyl-2-(2-tributylsilyloxyethyl)butanamide |
| SMILES | CCCC[Si](CCCC)(CCCC)OCC[C@H](C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C29H53NO3Si/c1-8-11-21-34(22-12-9-2,23-13-10-3)33-20-19-27(24(4)5)29(32)30(7)25(6)28(31)26-17-15-14-16-18-26/h14-18,24-25,27-28,31H,8-13,19-23H2,1-7H3/t25-,27-,28+/m0/s1 |
| InChIKey | BHJUHBDYVCNFKI-RZDMPUFOSA-N |
| XLogP | 7.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.83 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|