C32H51NO3Si — CID 134917992
(2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-phenyl-4-tributylsilyloxybutanamide (PubChem CID 134917992) has the molecular formula C32H51NO3Si and a molecular weight of 525.85 g/mol. Its IUPAC name is (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-phenyl-4-tributylsilyloxybutanamide.
| Compound Name | (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-phenyl-4-tributylsilyloxybutanamide |
|---|---|
| PubChem CID | 134917992 |
| Molecular Formula | C32H51NO3Si |
| Molecular Weight | 525.85 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-phenyl-4-tributylsilyloxybutanamide |
| SMILES | CCCC[Si](CCCC)(CCCC)OCC[C@H](C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H51NO3Si/c1-6-9-24-37(25-10-7-2,26-11-8-3)36-23-22-30(28-18-14-12-15-19-28)32(35)33(5)27(4)31(34)29-20-16-13-17-21-29/h12-21,27,30-31,34H,6-11,22-26H2,1-5H3/t27-,30-,31+/m0/s1 |
| InChIKey | VCDFKNCGBODDCD-FKCXQASGSA-N |
| XLogP | 8.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.85 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|