C12H19NO2 — CID 134918072
(4aS,8aR)-2-(3-hydroxypropyl)-1,4,4a,5,8,8a-hexahydroisoquinolin-3-one (PubChem CID 134918072) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4aS,8aR)-2-(3-hydroxypropyl)-1,4,4a,5,8,8a-hexahydroisoquinolin-3-one.
| Compound Name | (4aS,8aR)-2-(3-hydroxypropyl)-1,4,4a,5,8,8a-hexahydroisoquinolin-3-one |
|---|---|
| PubChem CID | 134918072 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4aS,8aR)-2-(3-hydroxypropyl)-1,4,4a,5,8,8a-hexahydroisoquinolin-3-one |
| SMILES | O=C1C[C@@H]2CC=CC[C@H]2CN1CCCO |
| InChI | InChI=1S/C12H19NO2/c14-7-3-6-13-9-11-5-2-1-4-10(11)8-12(13)15/h1-2,10-11,14H,3-9H2/t10-,11-/m0/s1 |
| InChIKey | GUYPVGBHUQUCGM-QWRGUYRKSA-N |
| XLogP | 1.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|