About (E)-N-butyldec-4-enamide
(E)-N-butyldec-4-enamide (PubChem CID 134918141) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is (E)-N-butyldec-4-enamide.
Molecular Properties
| Compound Name | (E)-N-butyldec-4-enamide |
| PubChem CID | 134918141 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (E)-N-butyldec-4-enamide |
| SMILES | CCCCC/C=C/CCC(=O)NCCCC |
| InChI | InChI=1S/C14H27NO/c1-3-5-7-8-9-10-11-12-14(16)15-13-6-4-2/h9-10H,3-8,11-13H2,1-2H3,(H,15,16)/b10-9+ |
| InChIKey | QOPOXXBJUXGUPM-MDZDMXLPSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-butyldec-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-butyldec-4-enamide?
The IUPAC name of (E)-N-butyldec-4-enamide (CID 134918141) is (E)-N-butyldec-4-enamide.
What is the SMILES notation for (E)-N-butyldec-4-enamide?
The canonical SMILES for (E)-N-butyldec-4-enamide is CCCCC/C=C/CCC(=O)NCCCC.
What is the InChIKey of (E)-N-butyldec-4-enamide?
The InChIKey is QOPOXXBJUXGUPM-MDZDMXLPSA-N. The full InChI is InChI=1S/C14H27NO/c1-3-5-7-8-9-10-11-12-14(16)15-13-6-4-2/h9-10H,3-8,11-13H2,1-2H3,(H,15,16)/b10-9+.
What are the key properties of (E)-N-butyldec-4-enamide?
(E)-N-butyldec-4-enamide has a molecular weight of 225.38 g/mol, XLogP of 3.82, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-butyldec-4-enamide is sourced from PubChem (CID 134918141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).