C14H25NO2 — CID 134918150
(2E)-N-methoxy-N,5,9-trimethyldeca-2,8-dienamide (PubChem CID 134918150) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (2E)-N-methoxy-N,5,9-trimethyldeca-2,8-dienamide.
| Compound Name | (2E)-N-methoxy-N,5,9-trimethyldeca-2,8-dienamide |
|---|---|
| PubChem CID | 134918150 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (2E)-N-methoxy-N,5,9-trimethyldeca-2,8-dienamide |
| SMILES | CON(C)C(=O)/C=C/CC(C)CCC=C(C)C |
| InChI | InChI=1S/C14H25NO2/c1-12(2)8-6-9-13(3)10-7-11-14(16)15(4)17-5/h7-8,11,13H,6,9-10H2,1-5H3/b11-7+ |
| InChIKey | SDNHHUAOGASCRA-YRNVUSSQSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|