C19H22F3NO4 — CID 134918200
methyl (3S)-3-(phenylmethoxymethyl)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 134918200) has the molecular formula C19H22F3NO4 and a molecular weight of 385.38 g/mol. Its IUPAC name is methyl (3S)-3-(phenylmethoxymethyl)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | methyl (3S)-3-(phenylmethoxymethyl)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 134918200 |
| Molecular Formula | C19H22F3NO4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl (3S)-3-(phenylmethoxymethyl)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | C=CCN(C(=O)C(F)(F)F)C(C(=O)OC)[C@H](C=C)COCc1ccccc1 |
| InChI | InChI=1S/C19H22F3NO4/c1-4-11-23(18(25)19(20,21)22)16(17(24)26-3)15(5-2)13-27-12-14-9-7-6-8-10-14/h4-10,15-16H,1-2,11-13H2,3H3/t15-,16?/m1/s1 |
| InChIKey | XKFYSBVJMLLYAW-AAFJCEBUSA-N |
| XLogP | 3.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|