About methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate
methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate (PubChem CID 134918216) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate |
| PubChem CID | 134918216 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1[C@@H](c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C15H21NO3/c1-11(14(17)18-4)16-13(10-19-15(16,2)3)12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3/t11-,13-/m1/s1 |
| InChIKey | MYZOQHSIDSOBLF-DGCLKSJQSA-N |
| XLogP | 2.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate?
The IUPAC name of methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate (CID 134918216) is methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate.
What is the SMILES notation for methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate?
The canonical SMILES for methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate is COC(=O)[C@@H](C)N1[C@@H](c2ccccc2)COC1(C)C.
What is the InChIKey of methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate?
The InChIKey is MYZOQHSIDSOBLF-DGCLKSJQSA-N. The full InChI is InChI=1S/C15H21NO3/c1-11(14(17)18-4)16-13(10-19-15(16,2)3)12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3/t11-,13-/m1/s1.
What are the key properties of methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate?
methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate has a molecular weight of 263.34 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]propanoate is sourced from PubChem (CID 134918216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).