C18H23NO4 — CID 134918251
[(4aR,8aS)-2-[methoxy(phenyl)methyl]-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-4-yl] acetate (PubChem CID 134918251) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is [(4aR,8aS)-2-[methoxy(phenyl)methyl]-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-4-yl] acetate.
| Compound Name | [(4aR,8aS)-2-[methoxy(phenyl)methyl]-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-4-yl] acetate |
|---|---|
| PubChem CID | 134918251 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(4aR,8aS)-2-[methoxy(phenyl)methyl]-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-4-yl] acetate |
| SMILES | COC(C1=NC(OC(C)=O)[C@@H]2CCCC[C@@H]2O1)c1ccccc1 |
| InChI | InChI=1S/C18H23NO4/c1-12(20)22-17-14-10-6-7-11-15(14)23-18(19-17)16(21-2)13-8-4-3-5-9-13/h3-5,8-9,14-17H,6-7,10-11H2,1-2H3/t14-,15+,16?,17?/m1/s1 |
| InChIKey | PWEBKSVTBQOYIQ-XNIRIUNOSA-N |
| XLogP | 3.25 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |