C22H25NO4 — CID 134918253
(3R,4R)-1-but-3-enyl-5-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-2-one (PubChem CID 134918253) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is (3R,4R)-1-but-3-enyl-5-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-2-one.
| Compound Name | (3R,4R)-1-but-3-enyl-5-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-2-one |
|---|---|
| PubChem CID | 134918253 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3R,4R)-1-but-3-enyl-5-hydroxy-3,4-bis(phenylmethoxy)pyrrolidin-2-one |
| SMILES | C=CCCN1C(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1O |
| InChI | InChI=1S/C22H25NO4/c1-2-3-14-23-21(24)19(26-15-17-10-6-4-7-11-17)20(22(23)25)27-16-18-12-8-5-9-13-18/h2,4-13,19-21,24H,1,3,14-16H2/t19-,20-,21?/m1/s1 |
| InChIKey | JCMSIEBWAROZCS-OSBQEZSISA-N |
| XLogP | 2.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|