About tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate
tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate (PubChem CID 134918266) has the molecular formula C18H27NO4
and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate |
| PubChem CID | 134918266 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate |
| SMILES | C/C=C/C=C/C(=O)CC(=O)C1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO4/c1-5-6-7-10-14(20)13-16(21)15-11-8-9-12-19(15)17(22)23-18(2,3)4/h5-7,10,15H,8-9,11-13H2,1-4H3/b6-5+,10-7+ |
| InChIKey | LHTCKAVCEBNVAZ-WEYXYWBQSA-N |
| XLogP | 3.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate (CID 134918266) is tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate is C/C=C/C=C/C(=O)CC(=O)C1CCCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate?
The InChIKey is LHTCKAVCEBNVAZ-WEYXYWBQSA-N. The full InChI is InChI=1S/C18H27NO4/c1-5-6-7-10-14(20)13-16(21)15-11-8-9-12-19(15)17(22)23-18(2,3)4/h5-7,10,15H,8-9,11-13H2,1-4H3/b6-5+,10-7+.
What are the key properties of tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate?
tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate has a molecular weight of 321.42 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(4E,6E)-3-oxoocta-4,6-dienoyl]piperidine-1-carboxylate is sourced from PubChem (CID 134918266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).