C18H31NO2 — CID 134918430
tert-butyl (2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate (PubChem CID 134918430) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate.
| Compound Name | tert-butyl (2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate |
|---|---|
| PubChem CID | 134918430 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | tert-butyl (2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate |
| SMILES | CC[C@H](/N=C1\C[C@H]2CC[C@]1(C)C2(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO2/c1-8-13(15(20)21-16(2,3)4)19-14-11-12-9-10-18(14,7)17(12,5)6/h12-13H,8-11H2,1-7H3/b19-14+/t12-,13+,18+/m1/s1 |
| InChIKey | KKDPCEHIGCFGHV-YMKJSNCTSA-N |
| XLogP | 4.39 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|