C15H20NO+ — CID 134918458
(4aS,8aS)-3-methyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-3-ium (PubChem CID 134918458) has the molecular formula C15H20NO+ and a molecular weight of 230.33 g/mol. Its IUPAC name is (4aS,8aS)-3-methyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-3-ium.
| Compound Name | (4aS,8aS)-3-methyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 134918458 |
| Molecular Formula | C15H20NO+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (4aS,8aS)-3-methyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazin-3-ium |
| SMILES | C[N+]1=C(c2ccccc2)O[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C15H20NO/c1-16-11-13-9-5-6-10-14(13)17-15(16)12-7-3-2-4-8-12/h2-4,7-8,13-14H,5-6,9-11H2,1H3/q+1/t13-,14-/m0/s1 |
| InChIKey | OQEZDAKJUBSKOM-KBPBESRZSA-N |
| XLogP | 2.66 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|