C15H24F2O4 — CID 134918465
diethyl 2,2-difluoro-3,6,6-trimethylcyclohexane-1,1-dicarboxylate (PubChem CID 134918465) has the molecular formula C15H24F2O4 and a molecular weight of 306.35 g/mol. Its IUPAC name is diethyl 2,2-difluoro-3,6,6-trimethylcyclohexane-1,1-dicarboxylate.
| Compound Name | diethyl 2,2-difluoro-3,6,6-trimethylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134918465 |
| Molecular Formula | C15H24F2O4 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | diethyl 2,2-difluoro-3,6,6-trimethylcyclohexane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C)(C)CCC(C)C1(F)F |
| InChI | InChI=1S/C15H24F2O4/c1-6-20-11(18)14(12(19)21-7-2)13(4,5)9-8-10(3)15(14,16)17/h10H,6-9H2,1-5H3 |
| InChIKey | XDOWZZOCJPMGFH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|