C19H33NO2 — CID 134918488
tert-butyl (2S)-3-methyl-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate (PubChem CID 134918488) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate |
|---|---|
| PubChem CID | 134918488 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanoate |
| SMILES | CC(C)[C@H](/N=C1\C[C@H]2CC[C@]1(C)C2(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO2/c1-12(2)15(16(21)22-17(3,4)5)20-14-11-13-9-10-19(14,8)18(13,6)7/h12-13,15H,9-11H2,1-8H3/b20-14+/t13-,15+,19+/m1/s1 |
| InChIKey | SLMAGPWQMCCEDB-ZJSLJOOFSA-N |
| XLogP | 4.64 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|