About [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate
[(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate (PubChem CID 134918503) has the molecular formula C16H17NO3S
and a molecular weight of 303.38 g/mol. Its IUPAC name is [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate |
| PubChem CID | 134918503 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate |
| SMILES | C=C=CCN1C(=O)C[C@H](OC(C)=O)C1Sc1ccccc1 |
| InChI | InChI=1S/C16H17NO3S/c1-3-4-10-17-15(19)11-14(20-12(2)18)16(17)21-13-8-6-5-7-9-13/h4-9,14,16H,1,10-11H2,2H3/t14-,16?/m0/s1 |
| InChIKey | XUWDIYLRDPKMCZ-LBAUFKAWSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate?
The IUPAC name of [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate (CID 134918503) is [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate.
What is the SMILES notation for [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate?
The canonical SMILES for [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate is C=C=CCN1C(=O)C[C@H](OC(C)=O)C1Sc1ccccc1.
What is the InChIKey of [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate?
The InChIKey is XUWDIYLRDPKMCZ-LBAUFKAWSA-N. The full InChI is InChI=1S/C16H17NO3S/c1-3-4-10-17-15(19)11-14(20-12(2)18)16(17)21-13-8-6-5-7-9-13/h4-9,14,16H,1,10-11H2,2H3/t14-,16?/m0/s1.
What are the key properties of [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate?
[(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate has a molecular weight of 303.38 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-buta-2,3-dienyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate is sourced from PubChem (CID 134918503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).