C26H48O3Si — CID 134918631
methyl (Z)-3-[(1R,3aR,4R,5R,7aR)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]but-2-enoate (PubChem CID 134918631) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is methyl (Z)-3-[(1R,3aR,4R,5R,7aR)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]but-2-enoate.
| Compound Name | methyl (Z)-3-[(1R,3aR,4R,5R,7aR)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]but-2-enoate |
|---|---|
| PubChem CID | 134918631 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | methyl (Z)-3-[(1R,3aR,4R,5R,7aR)-4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-7a-methyl-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]but-2-enoate |
| SMILES | COC(=O)/C=C(/C)[C@H]1CC[C@]2(C)[C@@H](C(C)C)CC[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C26H48O3Si/c1-17(2)21-12-13-22-24(29-30(10,11)25(6,7)18(3)4)20(14-15-26(21,22)8)19(5)16-23(27)28-9/h16-18,20-22,24H,12-15H2,1-11H3/b19-16-/t20-,21-,22+,24-,26-/m1/s1 |
| InChIKey | KQUVKTFSFPRLEF-FXAPOCFLSA-N |
| XLogP | 7.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|