C14H14O2Se — CID 134918725
(1S,2S,3S,6S,7R)-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 134918725) has the molecular formula C14H14O2Se and a molecular weight of 293.22 g/mol. Its IUPAC name is (1S,2S,3S,6S,7R)-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | (1S,2S,3S,6S,7R)-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 134918725 |
| Molecular Formula | C14H14O2Se |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | (1S,2S,3S,6S,7R)-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | O=C1O[C@H]2[C@@H]3C[C@@H](C[C@H]13)[C@@H]2[Se]c1ccccc1 |
| InChI | InChI=1S/C14H14O2Se/c15-14-11-7-8-6-10(11)12(16-14)13(8)17-9-4-2-1-3-5-9/h1-5,8,10-13H,6-7H2/t8-,10+,11-,12-,13-/m0/s1 |
| InChIKey | BPTKVFRJNYVSLR-YIQGNQSOSA-N |
| XLogP | 1.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|