About (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one
(2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one (PubChem CID 134918755) has the molecular formula C27H36O3Si
and a molecular weight of 436.67 g/mol. Its IUPAC name is (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one |
| PubChem CID | 134918755 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one |
| SMILES | C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](C)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C27H36O3Si/c1-21(20-22(2)25-16-17-26(28)30-25)18-19-29-31(27(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-17,21-22,25H,18-20H2,1-5H3/t21-,22-,25-/m1/s1 |
| InChIKey | SSNJGCMHPKOTDR-TZBSWOFLSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one?
The IUPAC name of (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one (CID 134918755) is (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one.
What is the SMILES notation for (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one?
The canonical SMILES for (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one is C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](C)[C@H]1C=CC(=O)O1.
What is the InChIKey of (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one?
The InChIKey is SSNJGCMHPKOTDR-TZBSWOFLSA-N. The full InChI is InChI=1S/C27H36O3Si/c1-21(20-22(2)25-16-17-26(28)30-25)18-19-29-31(27(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-17,21-22,25H,18-20H2,1-5H3/t21-,22-,25-/m1/s1.
What are the key properties of (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one?
(2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one has a molecular weight of 436.67 g/mol, XLogP of 5.10, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhexan-2-yl]-2H-furan-5-one is sourced from PubChem (CID 134918755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).