About (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide
(R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide (PubChem CID 134918776) has the molecular formula C16H27NO4S
and a molecular weight of 329.46 g/mol. Its IUPAC name is (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide.
Molecular Properties
| Compound Name | (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide |
| PubChem CID | 134918776 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide |
| SMILES | CCOC(OCC)(OCC)[C@H](C)N[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H27NO4S/c1-6-19-16(20-7-2,21-8-3)14(5)17-22(18)15-11-9-13(4)10-12-15/h9-12,14,17H,6-8H2,1-5H3/t14-,22+/m0/s1 |
| InChIKey | WCLVGXUZSKXYBE-RCDICMHDSA-N |
| XLogP | 2.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide?
The IUPAC name of (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide (CID 134918776) is (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide.
What is the SMILES notation for (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide?
The canonical SMILES for (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide is CCOC(OCC)(OCC)[C@H](C)N[S@](=O)c1ccc(C)cc1.
What is the InChIKey of (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide?
The InChIKey is WCLVGXUZSKXYBE-RCDICMHDSA-N. The full InChI is InChI=1S/C16H27NO4S/c1-6-19-16(20-7-2,21-8-3)14(5)17-22(18)15-11-9-13(4)10-12-15/h9-12,14,17H,6-8H2,1-5H3/t14-,22+/m0/s1.
What are the key properties of (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide?
(R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide has a molecular weight of 329.46 g/mol, XLogP of 2.76, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-4-methyl-N-[(2S)-1,1,1-triethoxypropan-2-yl]benzenesulfinamide is sourced from PubChem (CID 134918776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).