C34H62O6Si — CID 134918823
(1R,3S,5S,7R,9S,13R,15S,18S)-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-7-tri(propan-2-yl)silyloxy-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 134918823) has the molecular formula C34H62O6Si and a molecular weight of 594.95 g/mol. Its IUPAC name is (1R,3S,5S,7R,9S,13R,15S,18S)-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-7-tri(propan-2-yl)silyloxy-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1R,3S,5S,7R,9S,13R,15S,18S)-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-7-tri(propan-2-yl)silyloxy-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 134918823 |
| Molecular Formula | C34H62O6Si |
| Molecular Weight | 594.95 g/mol |
| Exact Mass | 594.43 |
| IUPAC Name | (1R,3S,5S,7R,9S,13R,15S,18S)-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-7-tri(propan-2-yl)silyloxy-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CO[C@H]1C[C@H]2C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](CC(=O)O[C@@H](/C=C/CC(C)C)C[C@@H]3CC[C@H](C)[C@@H](C1)O3)O2 |
| InChI | InChI=1S/C34H62O6Si/c1-22(2)12-11-13-27-16-28-15-14-26(9)33(38-28)20-29(36-10)17-30-18-32(19-31(37-30)21-34(35)39-27)40-41(23(3)4,24(5)6)25(7)8/h11,13,22-33H,12,14-21H2,1-10H3/b13-11+/t26-,27-,28-,29-,30-,31-,32+,33+/m0/s1 |
| InChIKey | JGEGVIGLUAFFDK-XANNZDABSA-N |
| XLogP | 8.38 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.95 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|