C18H28F6O3Si — CID 134918928
1,1,1,3,3,3-hexafluoropropan-2-yl (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[3.2.0]heptane-6-carboxylate (PubChem CID 134918928) has the molecular formula C18H28F6O3Si and a molecular weight of 434.49 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[3.2.0]heptane-6-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[3.2.0]heptane-6-carboxylate |
|---|---|
| PubChem CID | 134918928 |
| Molecular Formula | C18H28F6O3Si |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[3.2.0]heptane-6-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CCC[C@@]1(C)C[C@@H]2C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H28F6O3Si/c1-14(2,3)28(5,6)27-16-9-7-8-15(16,4)10-11(16)12(25)26-13(17(19,20)21)18(22,23)24/h11,13H,7-10H2,1-6H3/t11-,15+,16+/m1/s1 |
| InChIKey | HODUBEUDPJUBLO-RLCCDNCMSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|