C17H28F2O4 — CID 134918963
diethyl 2,2-difluoro-3,8,8-trimethylcyclooctane-1,1-dicarboxylate (PubChem CID 134918963) has the molecular formula C17H28F2O4 and a molecular weight of 334.40 g/mol. Its IUPAC name is diethyl 2,2-difluoro-3,8,8-trimethylcyclooctane-1,1-dicarboxylate.
| Compound Name | diethyl 2,2-difluoro-3,8,8-trimethylcyclooctane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134918963 |
| Molecular Formula | C17H28F2O4 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | diethyl 2,2-difluoro-3,8,8-trimethylcyclooctane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C)(C)CCCCC(C)C1(F)F |
| InChI | InChI=1S/C17H28F2O4/c1-6-22-13(20)16(14(21)23-7-2)15(4,5)11-9-8-10-12(3)17(16,18)19/h12H,6-11H2,1-5H3 |
| InChIKey | ZTFAGOVYMOMCNY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|