C9H12F3NO3 — CID 134918982
(2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid (PubChem CID 134918982) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid.
| Compound Name | (2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 134918982 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid |
| SMILES | C=C[C@H](C)[C@](C)(NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H12F3NO3/c1-4-5(2)8(3,7(15)16)13-6(14)9(10,11)12/h4-5H,1H2,2-3H3,(H,13,14)(H,15,16)/t5-,8-/m0/s1 |
| InChIKey | ARJQZCSPKHSIOX-XNCJUZBTSA-N |
| XLogP | 1.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|