C21H23NO5 — CID 134919033
dimethyl (2R,4S)-5-(2-methoxyphenyl)-2-phenylpyrrolidine-2,4-dicarboxylate (PubChem CID 134919033) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is dimethyl (2R,4S)-5-(2-methoxyphenyl)-2-phenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2R,4S)-5-(2-methoxyphenyl)-2-phenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134919033 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | dimethyl (2R,4S)-5-(2-methoxyphenyl)-2-phenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@](C(=O)OC)(c2ccccc2)NC1c1ccccc1OC |
| InChI | InChI=1S/C21H23NO5/c1-25-17-12-8-7-11-15(17)18-16(19(23)26-2)13-21(22-18,20(24)27-3)14-9-5-4-6-10-14/h4-12,16,18,22H,13H2,1-3H3/t16-,18?,21+/m0/s1 |
| InChIKey | DHHMNHXGWDUKNB-QSCSDJCXSA-N |
| XLogP | 2.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |