About ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate
ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate (PubChem CID 134919074) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate |
| PubChem CID | 134919074 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate |
| SMILES | CCOC(=O)CCC[C@@]1(C)OC(=O)C[C@@H]1C |
| InChI | InChI=1S/C12H20O4/c1-4-15-10(13)6-5-7-12(3)9(2)8-11(14)16-12/h9H,4-8H2,1-3H3/t9-,12+/m0/s1 |
| InChIKey | LGFCRVBJIBPOSU-JOYOIKCWSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate?
The IUPAC name of ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate (CID 134919074) is ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate.
What is the SMILES notation for ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate?
The canonical SMILES for ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate is CCOC(=O)CCC[C@@]1(C)OC(=O)C[C@@H]1C.
What is the InChIKey of ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate?
The InChIKey is LGFCRVBJIBPOSU-JOYOIKCWSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-15-10(13)6-5-7-12(3)9(2)8-11(14)16-12/h9H,4-8H2,1-3H3/t9-,12+/m0/s1.
What are the key properties of ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate?
ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate has a molecular weight of 228.29 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2R,3S)-2,3-dimethyl-5-oxooxolan-2-yl]butanoate is sourced from PubChem (CID 134919074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).